C13H11Cl3F3N3O — CID 15096584
4,4,4-trichloro-1-(1,2,4-triazol-1-yl)-2-[4-(trifluoromethyl)phenyl]butan-2-ol (PubChem CID 15096584) has the molecular formula C13H11Cl3F3N3O and a molecular weight of 388.60 g/mol. Its IUPAC name is 4,4,4-trichloro-1-(1,2,4-triazol-1-yl)-2-[4-(trifluoromethyl)phenyl]butan-2-ol.
| Compound Name | 4,4,4-trichloro-1-(1,2,4-triazol-1-yl)-2-[4-(trifluoromethyl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 15096584 |
| Molecular Formula | C13H11Cl3F3N3O |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 4,4,4-trichloro-1-(1,2,4-triazol-1-yl)-2-[4-(trifluoromethyl)phenyl]butan-2-ol |
| SMILES | OC(Cn1cncn1)(CC(Cl)(Cl)Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11Cl3F3N3O/c14-12(15,16)5-11(23,6-22-8-20-7-21-22)9-1-3-10(4-2-9)13(17,18)19/h1-4,7-8,23H,5-6H2 |
| InChIKey | DYOYHJSUINXDNI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|