C16H19F3N6O — CID 172956588
N-ethylidene-N'-[[3-hydroxy-4-(1,2,4-triazol-1-yl)-3-[4-(trifluoromethyl)phenyl]butyl]amino]methanimidamide (PubChem CID 172956588) has the molecular formula C16H19F3N6O and a molecular weight of 368.36 g/mol. Its IUPAC name is N-ethylidene-N'-[[3-hydroxy-4-(1,2,4-triazol-1-yl)-3-[4-(trifluoromethyl)phenyl]butyl]amino]methanimidamide.
| Compound Name | N-ethylidene-N'-[[3-hydroxy-4-(1,2,4-triazol-1-yl)-3-[4-(trifluoromethyl)phenyl]butyl]amino]methanimidamide |
|---|---|
| PubChem CID | 172956588 |
| Molecular Formula | C16H19F3N6O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-ethylidene-N'-[[3-hydroxy-4-(1,2,4-triazol-1-yl)-3-[4-(trifluoromethyl)phenyl]butyl]amino]methanimidamide |
| SMILES | C/C=N/C=N\NCCC(O)(Cn1cncn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N6O/c1-2-20-10-23-22-8-7-15(26,9-25-12-21-11-24-25)13-3-5-14(6-4-13)16(17,18)19/h2-6,10-12,22,26H,7-9H2,1H3/b20-2+,23-10- |
| InChIKey | AVTZMEAMOJMXDL-LBIYWIQGSA-N |
| XLogP | 2.20 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|