C24H20ClF6N3O2 — CID 171759266
2-(4-chloro-2-fluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol (PubChem CID 171759266) has the molecular formula C24H20ClF6N3O2 and a molecular weight of 531.88 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol |
|---|---|
| PubChem CID | 171759266 |
| Molecular Formula | C24H20ClF6N3O2 |
| Molecular Weight | 531.88 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol |
| SMILES | OC(Cn1cncn1)(c1ccc(Cl)cc1F)C(F)(F)C12CC(c3ccc(OCC(F)(F)F)cc3)(C1)C2 |
| InChI | InChI=1S/C24H20ClF6N3O2/c25-16-3-6-18(19(26)7-16)22(35,11-34-14-32-13-33-34)24(30,31)21-8-20(9-21,10-21)15-1-4-17(5-2-15)36-12-23(27,28)29/h1-7,13-14,35H,8-12H2 |
| InChIKey | BMWIVTOSWSQTJD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.88 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |