C26H26F4N4O3S — CID 171759504
2-(2,4-difluorophenyl)-1-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1-bicyclo[1.1.1]pentanyl]-1,1-difluoro-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 171759504) has the molecular formula C26H26F4N4O3S and a molecular weight of 550.58 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1-bicyclo[1.1.1]pentanyl]-1,1-difluoro-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1-bicyclo[1.1.1]pentanyl]-1,1-difluoro-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 171759504 |
| Molecular Formula | C26H26F4N4O3S |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1-bicyclo[1.1.1]pentanyl]-1,1-difluoro-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | O=S1(=O)CCN(c2ccc(C34CC(C(F)(F)C(O)(Cn5cncn5)c5ccc(F)cc5F)(C3)C4)cc2)CC1 |
| InChI | InChI=1S/C26H26F4N4O3S/c27-19-3-6-21(22(28)11-19)25(35,15-34-17-31-16-32-34)26(29,30)24-12-23(13-24,14-24)18-1-4-20(5-2-18)33-7-9-38(36,37)10-8-33/h1-6,11,16-17,35H,7-10,12-15H2 |
| InChIKey | XXPMNLDCEDLCMY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |