C25H22F7N3O3 — CID 171759956
(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[3-[4-[(2R)-3,3,3-trifluoro-2-hydroxypropoxy]phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol (PubChem CID 171759956) has the molecular formula C25H22F7N3O3 and a molecular weight of 545.46 g/mol. Its IUPAC name is (2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[3-[4-[(2R)-3,3,3-trifluoro-2-hydroxypropoxy]phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol.
| Compound Name | (2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[3-[4-[(2R)-3,3,3-trifluoro-2-hydroxypropoxy]phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol |
|---|---|
| PubChem CID | 171759956 |
| Molecular Formula | C25H22F7N3O3 |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | (2R)-2-(2,4-difluorophenyl)-1,1-difluoro-3-(1,2,4-triazol-1-yl)-1-[3-[4-[(2R)-3,3,3-trifluoro-2-hydroxypropoxy]phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol |
| SMILES | O[C@H](COc1ccc(C23CC(C(F)(F)[C@](O)(Cn4cncn4)c4ccc(F)cc4F)(C2)C3)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H22F7N3O3/c26-16-3-6-18(19(27)7-16)23(37,12-35-14-33-13-34-35)25(31,32)22-9-21(10-22,11-22)15-1-4-17(5-2-15)38-8-20(36)24(28,29)30/h1-7,13-14,20,36-37H,8-12H2/t20-,21?,22?,23+/m1/s1 |
| InChIKey | QADVZVABTMBDQD-PLYUQDFWSA-N |
| XLogP | 4.50 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |