C24H22F5N3O2 — CID 171759280
(2S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol (PubChem CID 171759280) has the molecular formula C24H22F5N3O2 and a molecular weight of 479.45 g/mol. Its IUPAC name is (2S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol.
| Compound Name | (2S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol |
|---|---|
| PubChem CID | 171759280 |
| Molecular Formula | C24H22F5N3O2 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (2S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]propan-2-ol |
| SMILES | O[C@@](Cn1cncn1)(CC12CC(c3ccc(OCC(F)(F)F)cc3)(C1)C2)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H22F5N3O2/c25-17-3-6-19(20(26)7-17)23(33,12-32-15-30-14-31-32)11-21-8-22(9-21,10-21)16-1-4-18(5-2-16)34-13-24(27,28)29/h1-7,14-15,33H,8-13H2/t21?,22?,23-/m1/s1 |
| InChIKey | FABDCDQYOMSWAN-XPPIMPSXSA-N |
| XLogP | 4.90 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |