C25H24F5N3O2 — CID 171759461
(2S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]butan-2-ol (PubChem CID 171759461) has the molecular formula C25H24F5N3O2 and a molecular weight of 493.48 g/mol. Its IUPAC name is (2S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]butan-2-ol.
| Compound Name | (2S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]butan-2-ol |
|---|---|
| PubChem CID | 171759461 |
| Molecular Formula | C25H24F5N3O2 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (2S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[3-[4-(2,2,2-trifluoroethoxy)phenyl]-1-bicyclo[1.1.1]pentanyl]butan-2-ol |
| SMILES | CC(C12CC(c3ccc(OCC(F)(F)F)cc3)(C1)C2)[C@@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H24F5N3O2/c1-16(24(34,12-33-15-31-14-32-33)20-7-4-18(26)8-21(20)27)22-9-23(10-22,11-22)17-2-5-19(6-3-17)35-13-25(28,29)30/h2-8,14-16,34H,9-13H2,1H3/t16?,22?,23?,24-/m0/s1 |
| InChIKey | FIOVBIVRCMNXDM-LIPXEAEJSA-N |
| XLogP | 5.14 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |