C35H27F6N5O4 — CID 20605135
N-(4-cyano-2,3,5,6-tetrafluorophenyl)-6-[5-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butyl]-1,3-dioxan-2-yl]naphthalene-2-carboxamide (PubChem CID 20605135) has the molecular formula C35H27F6N5O4 and a molecular weight of 695.62 g/mol. Its IUPAC name is N-(4-cyano-2,3,5,6-tetrafluorophenyl)-6-[5-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butyl]-1,3-dioxan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-(4-cyano-2,3,5,6-tetrafluorophenyl)-6-[5-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butyl]-1,3-dioxan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 20605135 |
| Molecular Formula | C35H27F6N5O4 |
| Molecular Weight | 695.62 g/mol |
| Exact Mass | 695.20 |
| IUPAC Name | N-(4-cyano-2,3,5,6-tetrafluorophenyl)-6-[5-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butyl]-1,3-dioxan-2-yl]naphthalene-2-carboxamide |
| SMILES | CC(CC1COC(c2ccc3cc(C(=O)Nc4c(F)c(F)c(C#N)c(F)c4F)ccc3c2)OC1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C35H27F6N5O4/c1-18(35(48,15-46-17-43-16-44-46)26-7-6-24(36)11-27(26)37)8-19-13-49-34(50-14-19)23-5-3-20-9-22(4-2-21(20)10-23)33(47)45-32-30(40)28(38)25(12-42)29(39)31(32)41/h2-7,9-11,16-19,34,48H,8,13-15H2,1H3,(H,45,47) |
| InChIKey | ZHLIJBMAAIRQHA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|