C34H29F2N5O4S — CID 20605133
N-(4-cyanophenyl)-6-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]naphthalene-2-carboxamide (PubChem CID 20605133) has the molecular formula C34H29F2N5O4S and a molecular weight of 641.70 g/mol. Its IUPAC name is N-(4-cyanophenyl)-6-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-(4-cyanophenyl)-6-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 20605133 |
| Molecular Formula | C34H29F2N5O4S |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 641.19 |
| IUPAC Name | N-(4-cyanophenyl)-6-[5-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanyl-1,3-dioxan-2-yl]naphthalene-2-carboxamide |
| SMILES | C[C@@H](SC1COC(c2ccc3cc(C(=O)Nc4ccc(C#N)cc4)ccc3c2)OC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C34H29F2N5O4S/c1-21(34(43,18-41-20-38-19-39-41)30-11-8-27(35)14-31(30)36)46-29-16-44-33(45-17-29)26-7-5-23-12-25(6-4-24(23)13-26)32(42)40-28-9-2-22(15-37)3-10-28/h2-14,19-21,29,33,43H,16-18H2,1H3,(H,40,42)/t21-,29?,33?,34-/m1/s1 |
| InChIKey | WKWRYKWEDIAFHI-FFTBAOTISA-N |
| XLogP | 5.96 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |