C26H23F3N4O3S — CID 10143086
4-[(1E,3E)-4-[5-[(1R,2S)-1-(2,4-difluorophenyl)-1-hydroxy-1-(1,2,4-triazol-1-yl)propan-2-yl]sulfanyl-1,3-dioxan-2-yl]buta-1,3-dienyl]-3-fluorobenzonitrile (PubChem CID 10143086) has the molecular formula C26H23F3N4O3S and a molecular weight of 528.56 g/mol. Its IUPAC name is 4-[(1E,3E)-4-[5-[(1R,2S)-1-(2,4-difluorophenyl)-1-hydroxy-1-(1,2,4-triazol-1-yl)propan-2-yl]sulfanyl-1,3-dioxan-2-yl]buta-1,3-dienyl]-3-fluorobenzonitrile.
| Compound Name | 4-[(1E,3E)-4-[5-[(1R,2S)-1-(2,4-difluorophenyl)-1-hydroxy-1-(1,2,4-triazol-1-yl)propan-2-yl]sulfanyl-1,3-dioxan-2-yl]buta-1,3-dienyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 10143086 |
| Molecular Formula | C26H23F3N4O3S |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 4-[(1E,3E)-4-[5-[(1R,2S)-1-(2,4-difluorophenyl)-1-hydroxy-1-(1,2,4-triazol-1-yl)propan-2-yl]sulfanyl-1,3-dioxan-2-yl]buta-1,3-dienyl]-3-fluorobenzonitrile |
| SMILES | C[C@H](SC1COC(/C=C/C=C/c2ccc(C#N)cc2F)OC1)[C@](O)(c1ccc(F)cc1F)n1cncn1 |
| InChI | InChI=1S/C26H23F3N4O3S/c1-17(26(34,33-16-31-15-32-33)22-9-8-20(27)11-24(22)29)37-21-13-35-25(36-14-21)5-3-2-4-19-7-6-18(12-30)10-23(19)28/h2-11,15-17,21,25,34H,13-14H2,1H3/b4-2+,5-3+/t17-,21?,25?,26-/m0/s1 |
| InChIKey | IVTKINUICYVPJA-IVDPMOOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|