C40H40F3N5O6S — CID 173142889
[3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 2-[4-(methylamino)butanoyloxymethyl]benzoate (PubChem CID 173142889) has the molecular formula C40H40F3N5O6S and a molecular weight of 775.85 g/mol. Its IUPAC name is [3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 2-[4-(methylamino)butanoyloxymethyl]benzoate.
| Compound Name | [3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 2-[4-(methylamino)butanoyloxymethyl]benzoate |
|---|---|
| PubChem CID | 173142889 |
| Molecular Formula | C40H40F3N5O6S |
| Molecular Weight | 775.85 g/mol |
| Exact Mass | 775.27 |
| IUPAC Name | [3-[[2-[4-(4-cyano-2-fluorophenyl)buta-1,3-dienyl]-1,3-dioxan-5-yl]sulfanyl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] 2-[4-(methylamino)butanoyloxymethyl]benzoate |
| SMILES | CNCCCC(=O)OCc1ccccc1C(=O)OC(Cn1cncn1)(c1ccc(F)cc1F)C(C)SC1COC(C=CC=Cc2ccc(C#N)cc2F)OC1 |
| InChI | InChI=1S/C40H40F3N5O6S/c1-27(55-32-22-52-38(53-23-32)12-6-4-8-29-14-13-28(20-44)18-35(29)42)40(24-48-26-46-25-47-48,34-16-15-31(41)19-36(34)43)54-39(50)33-10-5-3-9-30(33)21-51-37(49)11-7-17-45-2/h3-6,8-10,12-16,18-19,25-27,32,38,45H,7,11,17,21-24H2,1-2H3 |
| InChIKey | KPUTVASWJBAPCI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.85 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|