C23H22F2N6O3S — CID 10413643
methyl 2-[4-[1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-5-sulfanylidene-1,2,4-triazol-4-yl]phenyl]acetate (PubChem CID 10413643) has the molecular formula C23H22F2N6O3S and a molecular weight of 500.53 g/mol. Its IUPAC name is methyl 2-[4-[1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-5-sulfanylidene-1,2,4-triazol-4-yl]phenyl]acetate.
| Compound Name | methyl 2-[4-[1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-5-sulfanylidene-1,2,4-triazol-4-yl]phenyl]acetate |
|---|---|
| PubChem CID | 10413643 |
| Molecular Formula | C23H22F2N6O3S |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | methyl 2-[4-[1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-5-sulfanylidene-1,2,4-triazol-4-yl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(-n2cnn([C@H](C)[C@](O)(Cn3cncn3)c3ccc(F)cc3F)c2=S)cc1 |
| InChI | InChI=1S/C23H22F2N6O3S/c1-15(23(33,11-29-13-26-12-27-29)19-8-5-17(24)10-20(19)25)31-22(35)30(14-28-31)18-6-3-16(4-7-18)9-21(32)34-2/h3-8,10,12-15,33H,9,11H2,1-2H3/t15-,23-/m1/s1 |
| InChIKey | UPBBRMVXTURBCE-IQMFZBJNSA-N |
| XLogP | 3.14 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|