C17H23F2N5O3 — CID 11717915
tert-butyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]amino]carbamate (PubChem CID 11717915) has the molecular formula C17H23F2N5O3 and a molecular weight of 383.40 g/mol. Its IUPAC name is tert-butyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 11717915 |
| Molecular Formula | C17H23F2N5O3 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]amino]carbamate |
| SMILES | C[C@@H](NNC(=O)OC(C)(C)C)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H23F2N5O3/c1-11(22-23-15(25)27-16(2,3)4)17(26,8-24-10-20-9-21-24)13-6-5-12(18)7-14(13)19/h5-7,9-11,22,26H,8H2,1-4H3,(H,23,25)/t11-,17-/m1/s1 |
| InChIKey | CCOMFKPRFFFMRT-PIGZYNQJSA-N |
| XLogP | 1.86 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|