C25H27F5N6O3S — CID 91373320
tert-butyl N-[[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[[4-(trifluoromethyl)phenyl]carbamothioyl]amino]carbamate (PubChem CID 91373320) has the molecular formula C25H27F5N6O3S and a molecular weight of 586.59 g/mol. Its IUPAC name is tert-butyl N-[[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[[4-(trifluoromethyl)phenyl]carbamothioyl]amino]carbamate.
| Compound Name | tert-butyl N-[[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[[4-(trifluoromethyl)phenyl]carbamothioyl]amino]carbamate |
|---|---|
| PubChem CID | 91373320 |
| Molecular Formula | C25H27F5N6O3S |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | tert-butyl N-[[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[[4-(trifluoromethyl)phenyl]carbamothioyl]amino]carbamate |
| SMILES | CC(N(NC(=O)OC(C)(C)C)C(=S)Nc1ccc(C(F)(F)F)cc1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H27F5N6O3S/c1-15(24(38,12-35-14-31-13-32-35)19-10-7-17(26)11-20(19)27)36(34-22(37)39-23(2,3)4)21(40)33-18-8-5-16(6-9-18)25(28,29)30/h5-11,13-15,38H,12H2,1-4H3,(H,33,40)(H,34,37) |
| InChIKey | RYFGBWYDBKWBGR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|