C25H26F6N6O4S — CID 87969777
1-fluorobutyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[[4-(trifluoromethoxy)phenyl]carbamothioyl]amino]carbamate (PubChem CID 87969777) has the molecular formula C25H26F6N6O4S and a molecular weight of 620.58 g/mol. Its IUPAC name is 1-fluorobutyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[[4-(trifluoromethoxy)phenyl]carbamothioyl]amino]carbamate.
| Compound Name | 1-fluorobutyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[[4-(trifluoromethoxy)phenyl]carbamothioyl]amino]carbamate |
|---|---|
| PubChem CID | 87969777 |
| Molecular Formula | C25H26F6N6O4S |
| Molecular Weight | 620.58 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | 1-fluorobutyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[[4-(trifluoromethoxy)phenyl]carbamothioyl]amino]carbamate |
| SMILES | CCCC(F)OC(=O)NN(C(=S)Nc1ccc(OC(F)(F)F)cc1)[C@H](C)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H26F6N6O4S/c1-3-4-21(28)40-23(38)35-37(22(42)34-17-6-8-18(9-7-17)41-25(29,30)31)15(2)24(39,12-36-14-32-13-33-36)19-10-5-16(26)11-20(19)27/h5-11,13-15,21,39H,3-4,12H2,1-2H3,(H,34,42)(H,35,38)/t15-,21?,24-/m1/s1 |
| InChIKey | MNYGIKFPNIIAAF-BHJXPTNISA-N |
| XLogP | 5.17 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|