C27H29F2N7O3S — CID 10030903
tert-butyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-(quinolin-3-ylcarbamothioyl)amino]carbamate (PubChem CID 10030903) has the molecular formula C27H29F2N7O3S and a molecular weight of 569.64 g/mol. Its IUPAC name is tert-butyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-(quinolin-3-ylcarbamothioyl)amino]carbamate.
| Compound Name | tert-butyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-(quinolin-3-ylcarbamothioyl)amino]carbamate |
|---|---|
| PubChem CID | 10030903 |
| Molecular Formula | C27H29F2N7O3S |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | tert-butyl N-[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-(quinolin-3-ylcarbamothioyl)amino]carbamate |
| SMILES | C[C@@H](N(NC(=O)OC(C)(C)C)C(=S)Nc1cnc2ccccc2c1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H29F2N7O3S/c1-17(27(38,14-35-16-30-15-32-35)21-10-9-19(28)12-22(21)29)36(34-25(37)39-26(2,3)4)24(40)33-20-11-18-7-5-6-8-23(18)31-13-20/h5-13,15-17,38H,14H2,1-4H3,(H,33,40)(H,34,37)/t17-,27-/m1/s1 |
| InChIKey | PFNQTZSXDODAKQ-XGCWNURASA-N |
| XLogP | 4.52 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|