C27H32F2N6O5S — CID 10054139
methyl (2S)-2-[[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]carbamothioyl]amino]-2-phenylacetate (PubChem CID 10054139) has the molecular formula C27H32F2N6O5S and a molecular weight of 590.65 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]carbamothioyl]amino]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]carbamothioyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 10054139 |
| Molecular Formula | C27H32F2N6O5S |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]carbamothioyl]amino]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](NC(=S)N(NC(=O)OC(C)(C)C)[C@H](C)[C@](O)(Cn1cncn1)c1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C27H32F2N6O5S/c1-17(27(38,14-34-16-30-15-31-34)20-12-11-19(28)13-21(20)29)35(33-25(37)40-26(2,3)4)24(41)32-22(23(36)39-5)18-9-7-6-8-10-18/h6-13,15-17,22,38H,14H2,1-5H3,(H,32,41)(H,33,37)/t17-,22+,27-/m1/s1 |
| InChIKey | ZJVDFBZGYXPLPY-LGKCOBPISA-N |
| XLogP | 3.36 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|