C20H21F2N5O2 — CID 173310393
3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-N'-methoxybenzenecarboximidamide (PubChem CID 173310393) has the molecular formula C20H21F2N5O2 and a molecular weight of 401.42 g/mol. Its IUPAC name is 3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-N'-methoxybenzenecarboximidamide.
| Compound Name | 3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-N'-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 173310393 |
| Molecular Formula | C20H21F2N5O2 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-N'-methoxybenzenecarboximidamide |
| SMILES | CON=C(N)c1cccc(C(C)C(O)(Cn2cncn2)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C20H21F2N5O2/c1-13(14-4-3-5-15(8-14)19(23)26-29-2)20(28,10-27-12-24-11-25-27)17-7-6-16(21)9-18(17)22/h3-9,11-13,28H,10H2,1-2H3,(H2,23,26) |
| InChIKey | CJWNJCAYHYTNPB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|