C22H21F2N7OS — CID 87980192
1-amino-1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butan-2-yl]-3-quinolin-3-ylthiourea (PubChem CID 87980192) has the molecular formula C22H21F2N7OS and a molecular weight of 469.52 g/mol. Its IUPAC name is 1-amino-1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butan-2-yl]-3-quinolin-3-ylthiourea.
| Compound Name | 1-amino-1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butan-2-yl]-3-quinolin-3-ylthiourea |
|---|---|
| PubChem CID | 87980192 |
| Molecular Formula | C22H21F2N7OS |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 1-amino-1-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-5-yl)butan-2-yl]-3-quinolin-3-ylthiourea |
| SMILES | C[C@@H](N(N)C(=S)Nc1cnc2ccccc2c1)[C@@](O)(Cc1ncn[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H21F2N7OS/c1-13(31(25)21(33)29-16-8-14-4-2-3-5-19(14)26-11-16)22(32,10-20-27-12-28-30-20)17-7-6-15(23)9-18(17)24/h2-9,11-13,32H,10,25H2,1H3,(H,29,33)(H,27,28,30)/t13-,22+/m1/s1 |
| InChIKey | RJQGQJWKVQDYMI-DMZKTXOQSA-N |
| XLogP | 3.02 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|