C24H19ClF2N6O2 — CID 126558470
7-(4-chlorophenyl)-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]pyrrolo[1,2-d][1,2,4]triazin-4-one (PubChem CID 126558470) has the molecular formula C24H19ClF2N6O2 and a molecular weight of 496.91 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]pyrrolo[1,2-d][1,2,4]triazin-4-one.
| Compound Name | 7-(4-chlorophenyl)-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]pyrrolo[1,2-d][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 126558470 |
| Molecular Formula | C24H19ClF2N6O2 |
| Molecular Weight | 496.91 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 7-(4-chlorophenyl)-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]pyrrolo[1,2-d][1,2,4]triazin-4-one |
| SMILES | C[C@@H](n1ncc2cc(-c3ccc(Cl)cc3)cn2c1=O)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H19ClF2N6O2/c1-15(24(35,12-31-14-28-13-30-31)21-7-6-19(26)9-22(21)27)33-23(34)32-11-17(8-20(32)10-29-33)16-2-4-18(25)5-3-16/h2-11,13-15,35H,12H2,1H3/t15-,24-/m1/s1 |
| InChIKey | JXGZQXBVUVHESQ-OYLFLEFRSA-N |
| XLogP | 3.84 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.91 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |