C24H19F2N7O4 — CID 137370910
3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-7-(4-nitrophenyl)pyrrolo[1,2-d][1,2,4]triazin-4-one (PubChem CID 137370910) has the molecular formula C24H19F2N7O4 and a molecular weight of 507.46 g/mol. Its IUPAC name is 3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-7-(4-nitrophenyl)pyrrolo[1,2-d][1,2,4]triazin-4-one.
| Compound Name | 3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-7-(4-nitrophenyl)pyrrolo[1,2-d][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137370910 |
| Molecular Formula | C24H19F2N7O4 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 3-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-7-(4-nitrophenyl)pyrrolo[1,2-d][1,2,4]triazin-4-one |
| SMILES | CC(n1ncc2cc(-c3ccc([N+](=O)[O-])cc3)cn2c1=O)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H19F2N7O4/c1-15(24(35,12-30-14-27-13-29-30)21-7-4-18(25)9-22(21)26)32-23(34)31-11-17(8-20(31)10-28-32)16-2-5-19(6-3-16)33(36)37/h2-11,13-15,35H,12H2,1H3 |
| InChIKey | KDCHZKMBECQIHU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|