C20H18F2N6O3 — CID 68644866
(2R,3R)-2-(2,4-difluorophenyl)-3-(3-methyl-5-nitroindazol-2-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 68644866) has the molecular formula C20H18F2N6O3 and a molecular weight of 428.40 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-(3-methyl-5-nitroindazol-2-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-(3-methyl-5-nitroindazol-2-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 68644866 |
| Molecular Formula | C20H18F2N6O3 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-(3-methyl-5-nitroindazol-2-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | Cc1c2cc([N+](=O)[O-])ccc2nn1[C@H](C)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H18F2N6O3/c1-12-16-8-15(28(30)31)4-6-19(16)25-27(12)13(2)20(29,9-26-11-23-10-24-26)17-5-3-14(21)7-18(17)22/h3-8,10-11,13,29H,9H2,1-2H3/t13-,20-/m1/s1 |
| InChIKey | PQZAOTYLBVRLSA-ZUOKHONESA-N |
| XLogP | 3.27 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|