C22H19F2N7O3 — CID 66999671
(2R,3R)-2-(2,4-difluorophenyl)-3-[4-[2-(5-nitro-2-pyridinyl)ethenyl]pyrazol-1-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 66999671) has the molecular formula C22H19F2N7O3 and a molecular weight of 467.44 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[4-[2-(5-nitro-2-pyridinyl)ethenyl]pyrazol-1-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[4-[2-(5-nitro-2-pyridinyl)ethenyl]pyrazol-1-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 66999671 |
| Molecular Formula | C22H19F2N7O3 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[4-[2-(5-nitro-2-pyridinyl)ethenyl]pyrazol-1-yl]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](n1cc(C=Cc2ccc([N+](=O)[O-])cn2)cn1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H19F2N7O3/c1-15(22(32,12-29-14-25-13-28-29)20-7-3-17(23)8-21(20)24)30-11-16(9-27-30)2-4-18-5-6-19(10-26-18)31(33)34/h2-11,13-15,32H,12H2,1H3/t15-,22-/m1/s1 |
| InChIKey | WSQYTSOZFGNDMB-IVZQSRNASA-N |
| XLogP | 3.38 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|