C21H20F2N6O3 — CID 68644681
(2R,3R)-2-(2,4-difluorophenyl)-3-(3-ethyl-5-nitroindazol-2-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 68644681) has the molecular formula C21H20F2N6O3 and a molecular weight of 442.43 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-(3-ethyl-5-nitroindazol-2-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-(3-ethyl-5-nitroindazol-2-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 68644681 |
| Molecular Formula | C21H20F2N6O3 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-(3-ethyl-5-nitroindazol-2-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CCc1c2cc([N+](=O)[O-])ccc2nn1[C@H](C)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H20F2N6O3/c1-3-20-16-9-15(29(31)32)5-7-19(16)26-28(20)13(2)21(30,10-27-12-24-11-25-27)17-6-4-14(22)8-18(17)23/h4-9,11-13,30H,3,10H2,1-2H3/t13-,21-/m1/s1 |
| InChIKey | UZKDSAZVSGQIFP-LRTDBIEQSA-N |
| XLogP | 3.53 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|