C19H15F3N6O2 — CID 152591140
3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-6-fluoro-1,2,3-benzotriazin-4-one (PubChem CID 152591140) has the molecular formula C19H15F3N6O2 and a molecular weight of 416.36 g/mol. Its IUPAC name is 3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-6-fluoro-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-6-fluoro-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 152591140 |
| Molecular Formula | C19H15F3N6O2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-6-fluoro-1,2,3-benzotriazin-4-one |
| SMILES | C[C@@H](n1nnc2ccc(F)cc2c1=O)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H15F3N6O2/c1-11(28-18(29)14-6-12(20)3-5-17(14)25-26-28)19(30,8-27-10-23-9-24-27)15-4-2-13(21)7-16(15)22/h2-7,9-11,30H,8H2,1H3/t11-,19-/m1/s1 |
| InChIKey | YVMXBSDBKDVHDU-NSPYISDASA-N |
| XLogP | 1.95 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |