C29H26F3N7O3 — CID 11649936
4-[4-[[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-methylamino]methyl]phenyl]-2-[2-(4-fluorophenyl)-2-oxoethyl]-1,2,4-triazol-3-one (PubChem CID 11649936) has the molecular formula C29H26F3N7O3 and a molecular weight of 577.57 g/mol. Its IUPAC name is 4-[4-[[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-methylamino]methyl]phenyl]-2-[2-(4-fluorophenyl)-2-oxoethyl]-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-methylamino]methyl]phenyl]-2-[2-(4-fluorophenyl)-2-oxoethyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 11649936 |
| Molecular Formula | C29H26F3N7O3 |
| Molecular Weight | 577.57 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 4-[4-[[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-methylamino]methyl]phenyl]-2-[2-(4-fluorophenyl)-2-oxoethyl]-1,2,4-triazol-3-one |
| SMILES | CN(Cc1ccc(-n2cnn(CC(=O)c3ccc(F)cc3)c2=O)cc1)CC(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C29H26F3N7O3/c1-36(15-29(42,16-37-18-33-17-34-37)25-11-8-23(31)12-26(25)32)13-20-2-9-24(10-3-20)38-19-35-39(28(38)41)14-27(40)21-4-6-22(30)7-5-21/h2-12,17-19,42H,13-16H2,1H3 |
| InChIKey | KABXSDXINAJSBE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |