C31H35F2N5O5 — CID 155556387
3-[4-[3-[4-[[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-methylamino]methyl]phenoxy]propoxy]phenyl]-N-hydroxypropanamide (PubChem CID 155556387) has the molecular formula C31H35F2N5O5 and a molecular weight of 595.65 g/mol. Its IUPAC name is 3-[4-[3-[4-[[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-methylamino]methyl]phenoxy]propoxy]phenyl]-N-hydroxypropanamide.
| Compound Name | 3-[4-[3-[4-[[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-methylamino]methyl]phenoxy]propoxy]phenyl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 155556387 |
| Molecular Formula | C31H35F2N5O5 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 3-[4-[3-[4-[[[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-methylamino]methyl]phenoxy]propoxy]phenyl]-N-hydroxypropanamide |
| SMILES | CN(Cc1ccc(OCCCOc2ccc(CCC(=O)NO)cc2)cc1)CC(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C31H35F2N5O5/c1-37(19-31(40,20-38-22-34-21-35-38)28-13-8-25(32)17-29(28)33)18-24-5-11-27(12-6-24)43-16-2-15-42-26-9-3-23(4-10-26)7-14-30(39)36-41/h3-6,8-13,17,21-22,40-41H,2,7,14-16,18-20H2,1H3,(H,36,39) |
| InChIKey | DNSPSEJKTZAMAY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|