C28H36F2N6O4 — CID 164613157
6-[4-[[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]methyl]phenoxy]-N-hydroxyhexanamide (PubChem CID 164613157) has the molecular formula C28H36F2N6O4 and a molecular weight of 558.63 g/mol. Its IUPAC name is 6-[4-[[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]methyl]phenoxy]-N-hydroxyhexanamide.
| Compound Name | 6-[4-[[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]methyl]phenoxy]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 164613157 |
| Molecular Formula | C28H36F2N6O4 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 6-[4-[[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]methyl]phenoxy]-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCOc1ccc(CN2CCN(CC(O)(Cn3cncn3)c3ccc(F)cc3F)CC2)cc1)NO |
| InChI | InChI=1S/C28H36F2N6O4/c29-23-7-10-25(26(30)16-23)28(38,19-36-21-31-20-32-36)18-35-13-11-34(12-14-35)17-22-5-8-24(9-6-22)40-15-3-1-2-4-27(37)33-39/h5-10,16,20-21,38-39H,1-4,11-15,17-19H2,(H,33,37) |
| InChIKey | GOOMERVDDUTSBC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|