C28H29ClF2N6O3S — CID 163286101
(5E)-5-[(4-chlorophenyl)methylidene]-3-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione (PubChem CID 163286101) has the molecular formula C28H29ClF2N6O3S and a molecular weight of 603.10 g/mol. Its IUPAC name is (5E)-5-[(4-chlorophenyl)methylidene]-3-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-chlorophenyl)methylidene]-3-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 163286101 |
| Molecular Formula | C28H29ClF2N6O3S |
| Molecular Weight | 603.10 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | (5E)-5-[(4-chlorophenyl)methylidene]-3-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(Cl)cc2)C(=O)N1CCCN1CCN(CC(O)(Cn2cncn2)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C28H29ClF2N6O3S/c29-21-4-2-20(3-5-21)14-25-26(38)37(27(39)41-25)9-1-8-34-10-12-35(13-11-34)16-28(40,17-36-19-32-18-33-36)23-7-6-22(30)15-24(23)31/h2-7,14-15,18-19,40H,1,8-13,16-17H2/b25-14+ |
| InChIKey | WSUPJELWBKIYHI-AFUMVMLFSA-N |
| XLogP | 3.84 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.10 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|