C30H31ClF2N6O4S — CID 153409052
5-[(4-chlorophenyl)methylidene]-3-[5-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]-4-oxopentyl]-1,3-thiazolidine-2,4-dione (PubChem CID 153409052) has the molecular formula C30H31ClF2N6O4S and a molecular weight of 645.13 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylidene]-3-[5-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]-4-oxopentyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(4-chlorophenyl)methylidene]-3-[5-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]-4-oxopentyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 153409052 |
| Molecular Formula | C30H31ClF2N6O4S |
| Molecular Weight | 645.13 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | 5-[(4-chlorophenyl)methylidene]-3-[5-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]-4-oxopentyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CCCN1C(=O)SC(=Cc2ccc(Cl)cc2)C1=O)CN1CCN(CC(O)(Cn2cncn2)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C30H31ClF2N6O4S/c31-22-5-3-21(4-6-22)14-27-28(41)39(29(42)44-27)9-1-2-24(40)16-36-10-12-37(13-11-36)17-30(43,18-38-20-34-19-35-38)25-8-7-23(32)15-26(25)33/h3-8,14-15,19-20,43H,1-2,9-13,16-18H2 |
| InChIKey | DYXCLOAQODMWOR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.13 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|