C28H26Cl2F2N6O — CID 16728397
1-[4-[4-[(3,4-dichlorophenyl)methylideneamino]phenyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 16728397) has the molecular formula C28H26Cl2F2N6O and a molecular weight of 571.46 g/mol. Its IUPAC name is 1-[4-[4-[(3,4-dichlorophenyl)methylideneamino]phenyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-[4-[4-[(3,4-dichlorophenyl)methylideneamino]phenyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 16728397 |
| Molecular Formula | C28H26Cl2F2N6O |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 1-[4-[4-[(3,4-dichlorophenyl)methylideneamino]phenyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(CN1CCN(c2ccc(/N=C/c3ccc(Cl)c(Cl)c3)cc2)CC1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H26Cl2F2N6O/c29-25-8-1-20(13-26(25)30)15-34-22-3-5-23(6-4-22)37-11-9-36(10-12-37)16-28(39,17-38-19-33-18-35-38)24-7-2-21(31)14-27(24)32/h1-8,13-15,18-19,39H,9-12,16-17H2/b34-15+ |
| InChIKey | RWBXRJFYKDEKNP-PUHLOBNQSA-N |
| XLogP | 5.32 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|