C28H26F4N6O — CID 16728406
2-(2,4-difluorophenyl)-1-[4-[2-fluoro-4-[(4-fluorophenyl)methylideneamino]phenyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 16728406) has the molecular formula C28H26F4N6O and a molecular weight of 538.55 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[4-[2-fluoro-4-[(4-fluorophenyl)methylideneamino]phenyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[4-[2-fluoro-4-[(4-fluorophenyl)methylideneamino]phenyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 16728406 |
| Molecular Formula | C28H26F4N6O |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[4-[2-fluoro-4-[(4-fluorophenyl)methylideneamino]phenyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(CN1CCN(c2ccc(/N=C/c3ccc(F)cc3)cc2F)CC1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H26F4N6O/c29-21-3-1-20(2-4-21)15-34-23-6-8-27(26(32)14-23)37-11-9-36(10-12-37)16-28(39,17-38-19-33-18-35-38)24-7-5-22(30)13-25(24)31/h1-8,13-15,18-19,39H,9-12,16-17H2/b34-15+ |
| InChIKey | BFNLWUSNHJJGMK-PUHLOBNQSA-N |
| XLogP | 4.30 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|