C31H34F2N6O4S — CID 154929013
(5Z)-5-[(4-tert-butylphenyl)methylidene]-3-[2-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 154929013) has the molecular formula C31H34F2N6O4S and a molecular weight of 624.71 g/mol. Its IUPAC name is (5Z)-5-[(4-tert-butylphenyl)methylidene]-3-[2-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-tert-butylphenyl)methylidene]-3-[2-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154929013 |
| Molecular Formula | C31H34F2N6O4S |
| Molecular Weight | 624.71 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | (5Z)-5-[(4-tert-butylphenyl)methylidene]-3-[2-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)(C)c1ccc(/C=C2\SC(=O)N(CC(=O)N3CCN(CC(O)(Cn4cncn4)c4ccc(F)cc4F)CC3)C2=O)cc1 |
| InChI | InChI=1S/C31H34F2N6O4S/c1-30(2,3)22-6-4-21(5-7-22)14-26-28(41)39(29(42)44-26)16-27(40)37-12-10-36(11-13-37)17-31(43,18-38-20-34-19-35-38)24-9-8-23(32)15-25(24)33/h4-9,14-15,19-20,43H,10-13,16-18H2,1-3H3/b26-14- |
| InChIKey | XKRHFBXYDNHHQK-WGARJPEWSA-N |
| XLogP | 3.62 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|