C33H39ClF2N8O3S — CID 163286068
5-[[4-chloro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]-3-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione (PubChem CID 163286068) has the molecular formula C33H39ClF2N8O3S and a molecular weight of 701.24 g/mol. Its IUPAC name is 5-[[4-chloro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]-3-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-chloro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]-3-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 163286068 |
| Molecular Formula | C33H39ClF2N8O3S |
| Molecular Weight | 701.24 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | 5-[[4-chloro-2-(4-methylpiperazin-1-yl)phenyl]methylidene]-3-[3-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(c2cc(Cl)ccc2C=C2SC(=O)N(CCCN3CCN(CC(O)(Cn4cncn4)c4ccc(F)cc4F)CC3)C2=O)CC1 |
| InChI | InChI=1S/C33H39ClF2N8O3S/c1-39-9-15-42(16-10-39)29-18-25(34)4-3-24(29)17-30-31(45)44(32(46)48-30)8-2-7-40-11-13-41(14-12-40)20-33(47,21-43-23-37-22-38-43)27-6-5-26(35)19-28(27)36/h3-6,17-19,22-23,47H,2,7-16,20-21H2,1H3 |
| InChIKey | GPZXMEQZUBBPHD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|