C27H31F2N7O3S — CID 72945902
2-(2,4-difluorophenyl)-1-[4-[3-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 72945902) has the molecular formula C27H31F2N7O3S and a molecular weight of 571.65 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[4-[3-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[4-[3-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 72945902 |
| Molecular Formula | C27H31F2N7O3S |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[4-[3-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | COc1ccccc1-c1nnc(SCCCN2CCN(CC(O)(Cn3cncn3)c3ccc(F)cc3F)CC2)o1 |
| InChI | InChI=1S/C27H31F2N7O3S/c1-38-24-6-3-2-5-21(24)25-32-33-26(39-25)40-14-4-9-34-10-12-35(13-11-34)16-27(37,17-36-19-30-18-31-36)22-8-7-20(28)15-23(22)29/h2-3,5-8,15,18-19,37H,4,9-14,16-17H2,1H3 |
| InChIKey | CWZICUPGPFBLEO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|