C24H20FN3O3S — CID 71491465
(E)-1-[4-[2-(4-fluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 71491465) has the molecular formula C24H20FN3O3S and a molecular weight of 449.51 g/mol. Its IUPAC name is (E)-1-[4-[2-(4-fluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-(4-fluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 71491465 |
| Molecular Formula | C24H20FN3O3S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (E)-1-[4-[2-(4-fluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propoxy]phenyl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)c1ccc(OCC(O)(Cn2cncn2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H20FN3O3S/c25-20-7-5-19(6-8-20)24(30,14-28-17-26-16-27-28)15-31-21-9-3-18(4-10-21)23(29)12-11-22-2-1-13-32-22/h1-13,16-17,30H,14-15H2/b12-11+ |
| InChIKey | SOTQZSIKVPACGK-VAWYXSNFSA-N |
| XLogP | 4.34 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|