C29H24O4S2 — CID 139219859
(E)-3-thiophen-2-yl-1-[4-[3-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenoxy]propoxy]phenyl]prop-2-en-1-one (PubChem CID 139219859) has the molecular formula C29H24O4S2 and a molecular weight of 500.64 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-1-[4-[3-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenoxy]propoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-thiophen-2-yl-1-[4-[3-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenoxy]propoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139219859 |
| Molecular Formula | C29H24O4S2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | (E)-3-thiophen-2-yl-1-[4-[3-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenoxy]propoxy]phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)c1ccc(OCCCOc2ccc(C(=O)/C=C/c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C29H24O4S2/c30-28(16-14-26-4-1-20-34-26)22-6-10-24(11-7-22)32-18-3-19-33-25-12-8-23(9-13-25)29(31)17-15-27-5-2-21-35-27/h1-2,4-17,20-21H,3,18-19H2/b16-14+,17-15+ |
| InChIKey | PTUVKOBKXYFQOW-YXLFCKQPSA-N |
| XLogP | 7.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|