C41H36N4O2S2 — CID 139219881
N-[(E)-[(E)-1-[4-[3-[4-[(E)-N-anilino-C-[(E)-2-thiophen-2-ylethenyl]carbonimidoyl]phenoxy]propoxy]phenyl]-3-thiophen-2-ylprop-2-enylidene]amino]aniline (PubChem CID 139219881) has the molecular formula C41H36N4O2S2 and a molecular weight of 680.90 g/mol. Its IUPAC name is N-[(E)-[(E)-1-[4-[3-[4-[(E)-N-anilino-C-[(E)-2-thiophen-2-ylethenyl]carbonimidoyl]phenoxy]propoxy]phenyl]-3-thiophen-2-ylprop-2-enylidene]amino]aniline.
| Compound Name | N-[(E)-[(E)-1-[4-[3-[4-[(E)-N-anilino-C-[(E)-2-thiophen-2-ylethenyl]carbonimidoyl]phenoxy]propoxy]phenyl]-3-thiophen-2-ylprop-2-enylidene]amino]aniline |
|---|---|
| PubChem CID | 139219881 |
| Molecular Formula | C41H36N4O2S2 |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.23 |
| IUPAC Name | N-[(E)-[(E)-1-[4-[3-[4-[(E)-N-anilino-C-[(E)-2-thiophen-2-ylethenyl]carbonimidoyl]phenoxy]propoxy]phenyl]-3-thiophen-2-ylprop-2-enylidene]amino]aniline |
| SMILES | C(=C/c1cccs1)\C(=N/Nc1ccccc1)c1ccc(OCCCOc2ccc(C(/C=C/c3cccs3)=N/Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C41H36N4O2S2/c1-3-10-34(11-4-1)42-44-40(26-24-38-14-7-30-48-38)32-16-20-36(21-17-32)46-28-9-29-47-37-22-18-33(19-23-37)41(27-25-39-15-8-31-49-39)45-43-35-12-5-2-6-13-35/h1-8,10-27,30-31,42-43H,9,28-29H2/b26-24+,27-25+,44-40+,45-41+ |
| InChIKey | LYWUPKDISOHEIP-PGVRBRTNSA-N |
| XLogP | 10.72 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|