C30H26O4S2 — CID 139219860
(E)-3-thiophen-2-yl-1-[4-[4-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenoxy]butoxy]phenyl]prop-2-en-1-one (PubChem CID 139219860) has the molecular formula C30H26O4S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-1-[4-[4-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenoxy]butoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-thiophen-2-yl-1-[4-[4-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenoxy]butoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139219860 |
| Molecular Formula | C30H26O4S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | (E)-3-thiophen-2-yl-1-[4-[4-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenoxy]butoxy]phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)c1ccc(OCCCCOc2ccc(C(=O)/C=C/c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C30H26O4S2/c31-29(17-15-27-5-3-21-35-27)23-7-11-25(12-8-23)33-19-1-2-20-34-26-13-9-24(10-14-26)30(32)18-16-28-6-4-22-36-28/h3-18,21-22H,1-2,19-20H2/b17-15+,18-16+ |
| InChIKey | QDDLXQLHTOHYLB-YTEMWHBBSA-N |
| XLogP | 7.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|