About [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate
[4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate (PubChem CID 4555687) has the molecular formula C19H13BrO4S2
and a molecular weight of 449.35 g/mol. Its IUPAC name is [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate |
| PubChem CID | 4555687 |
| Molecular Formula | C19H13BrO4S2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 447.94 |
| IUPAC Name | [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate |
| SMILES | O=C(C=Cc1cccs1)c1ccc(OS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H13BrO4S2/c20-15-5-10-18(11-6-15)26(22,23)24-16-7-3-14(4-8-16)19(21)12-9-17-2-1-13-25-17/h1-13H |
| InChIKey | SLUUZRPTTYEAET-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate?
The IUPAC name of [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate (CID 4555687) is [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate.
What is the SMILES notation for [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate?
The canonical SMILES for [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate is O=C(C=Cc1cccs1)c1ccc(OS(=O)(=O)c2ccc(Br)cc2)cc1.
What is the InChIKey of [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate?
The InChIKey is SLUUZRPTTYEAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrO4S2/c20-15-5-10-18(11-6-15)26(22,23)24-16-7-3-14(4-8-16)19(21)12-9-17-2-1-13-25-17/h1-13H.
What are the key properties of [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate?
[4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate has a molecular weight of 449.35 g/mol, XLogP of 5.17, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-thiophen-2-ylprop-2-enoyl)phenyl] 4-bromobenzenesulfonate is sourced from PubChem (CID 4555687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).