C19H12Cl2O4S2 — CID 92948707
[4-[(Z)-3-thiophen-2-ylprop-2-enoyl]phenyl] 2,5-dichlorobenzenesulfonate (PubChem CID 92948707) has the molecular formula C19H12Cl2O4S2 and a molecular weight of 439.34 g/mol. Its IUPAC name is [4-[(Z)-3-thiophen-2-ylprop-2-enoyl]phenyl] 2,5-dichlorobenzenesulfonate.
| Compound Name | [4-[(Z)-3-thiophen-2-ylprop-2-enoyl]phenyl] 2,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 92948707 |
| Molecular Formula | C19H12Cl2O4S2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 437.96 |
| IUPAC Name | [4-[(Z)-3-thiophen-2-ylprop-2-enoyl]phenyl] 2,5-dichlorobenzenesulfonate |
| SMILES | O=C(/C=C\c1cccs1)c1ccc(OS(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C19H12Cl2O4S2/c20-14-5-9-17(21)19(12-14)27(23,24)25-15-6-3-13(4-7-15)18(22)10-8-16-2-1-11-26-16/h1-12H/b10-8- |
| InChIKey | ARKMGMHJSPBTRC-NTMALXAHSA-N |
| XLogP | 5.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|