C13H10O3S — CID 74983119
(E)-1-(3,5-dihydroxyphenyl)-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 74983119) has the molecular formula C13H10O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is (E)-1-(3,5-dihydroxyphenyl)-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-(3,5-dihydroxyphenyl)-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 74983119 |
| Molecular Formula | C13H10O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | (E)-1-(3,5-dihydroxyphenyl)-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H10O3S/c14-10-6-9(7-11(15)8-10)13(16)4-3-12-2-1-5-17-12/h1-8,14-15H/b4-3+ |
| InChIKey | FVJBMVYFGKPNHV-ONEGZZNKSA-N |
| XLogP | 3.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|