C21H17NO2S — CID 5344255
3-methyl-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]benzamide (PubChem CID 5344255) has the molecular formula C21H17NO2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 3-methyl-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 5344255 |
| Molecular Formula | C21H17NO2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-methyl-N-[4-[(E)-3-thiophen-2-ylprop-2-enoyl]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)/C=C/c3cccs3)cc2)c1 |
| InChI | InChI=1S/C21H17NO2S/c1-15-4-2-5-17(14-15)21(24)22-18-9-7-16(8-10-18)20(23)12-11-19-6-3-13-25-19/h2-14H,1H3,(H,22,24)/b12-11+ |
| InChIKey | BXKUHFRCLWGLOE-VAWYXSNFSA-N |
| XLogP | 5.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|