About CID 59090948
CID 59090948 (PubChem CID 59090948) has the molecular formula C8H6OS
and a molecular weight of 150.20 g/mol.
Molecular Properties
| Compound Name | CID 59090948 |
| PubChem CID | 59090948 |
| Molecular Formula | C8H6OS |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | — |
| SMILES | [CH]C(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C8H6OS/c1-7(9)4-5-8-3-2-6-10-8/h1-6H/b5-4+ |
| InChIKey | NEBUIISWGYRVGT-SNAWJCMRSA-N |
| XLogP | 2.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59090948 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59090948?
The IUPAC name of CID 59090948 (CID 59090948) is not available.
What is the SMILES notation for CID 59090948?
The canonical SMILES for CID 59090948 is [CH]C(=O)/C=C/c1cccs1.
What is the InChIKey of CID 59090948?
The InChIKey is NEBUIISWGYRVGT-SNAWJCMRSA-N. The full InChI is InChI=1S/C8H6OS/c1-7(9)4-5-8-3-2-6-10-8/h1-6H/b5-4+.
What are the key properties of CID 59090948?
CID 59090948 has a molecular weight of 150.20 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59090948 is sourced from PubChem (CID 59090948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).