C10H8F2O2S — CID 110209119
(3Z)-1,1-difluoro-4-hydroxy-6-thiophen-2-ylhexa-3,5-dien-2-one (PubChem CID 110209119) has the molecular formula C10H8F2O2S and a molecular weight of 230.24 g/mol. Its IUPAC name is (3Z)-1,1-difluoro-4-hydroxy-6-thiophen-2-ylhexa-3,5-dien-2-one.
| Compound Name | (3Z)-1,1-difluoro-4-hydroxy-6-thiophen-2-ylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 110209119 |
| Molecular Formula | C10H8F2O2S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | (3Z)-1,1-difluoro-4-hydroxy-6-thiophen-2-ylhexa-3,5-dien-2-one |
| SMILES | O=C(/C=C(\O)C=Cc1cccs1)C(F)F |
| InChI | InChI=1S/C10H8F2O2S/c11-10(12)9(14)6-7(13)3-4-8-2-1-5-15-8/h1-6,10,13H/b4-3?,7-6- |
| InChIKey | ZZQWKFWGAFCNAJ-JZATWXMZSA-N |
| XLogP | 3.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|