C9H7Cl4NOS — CID 118037754
(E)-N-(1,2,2,2-tetrachloroethyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 118037754) has the molecular formula C9H7Cl4NOS and a molecular weight of 319.04 g/mol. Its IUPAC name is (E)-N-(1,2,2,2-tetrachloroethyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(1,2,2,2-tetrachloroethyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 118037754 |
| Molecular Formula | C9H7Cl4NOS |
| Molecular Weight | 319.04 g/mol |
| Exact Mass | 316.90 |
| IUPAC Name | (E)-N-(1,2,2,2-tetrachloroethyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NC(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H7Cl4NOS/c10-8(9(11,12)13)14-7(15)4-3-6-2-1-5-16-6/h1-5,8H,(H,14,15)/b4-3+ |
| InChIKey | UTKNBIUBKOWPDO-ONEGZZNKSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.04 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|