About (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate
(4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate (PubChem CID 175599093) has the molecular formula C21H15IO4S
and a molecular weight of 490.32 g/mol. Its IUPAC name is (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate.
Molecular Properties
| Compound Name | (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate |
| PubChem CID | 175599093 |
| Molecular Formula | C21H15IO4S |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)Oc2ccc(I)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H15IO4S/c22-18-9-11-19(12-10-18)26-27(24,25)20-13-6-16(7-14-20)8-15-21(23)17-4-2-1-3-5-17/h1-15H/b15-8+ |
| InChIKey | PGUZJXHBBDUHDH-OVCLIPMQSA-N |
| XLogP | 4.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate?
The IUPAC name of (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate (CID 175599093) is (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate.
What is the SMILES notation for (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate?
The canonical SMILES for (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate is O=C(/C=C/c1ccc(S(=O)(=O)Oc2ccc(I)cc2)cc1)c1ccccc1.
What is the InChIKey of (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate?
The InChIKey is PGUZJXHBBDUHDH-OVCLIPMQSA-N. The full InChI is InChI=1S/C21H15IO4S/c22-18-9-11-19(12-10-18)26-27(24,25)20-13-6-16(7-14-20)8-15-21(23)17-4-2-1-3-5-17/h1-15H/b15-8+.
What are the key properties of (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate?
(4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate has a molecular weight of 490.32 g/mol, XLogP of 4.95, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodophenyl) 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzenesulfonate is sourced from PubChem (CID 175599093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).