C15H12FNO5S — CID 175271068
[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 175271068) has the molecular formula C15H12FNO5S and a molecular weight of 337.33 g/mol. Its IUPAC name is [4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 175271068 |
| Molecular Formula | C15H12FNO5S |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | [4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(C=Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)NO |
| InChI | InChI=1S/C15H12FNO5S/c16-12-4-8-14(9-5-12)23(20,21)22-13-6-1-11(2-7-13)3-10-15(18)17-19/h1-10,19H,(H,17,18) |
| InChIKey | CGYOLYWGTZKMRZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|