C11H13NO5S — CID 175271085
[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl] ethanesulfonate (PubChem CID 175271085) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is [4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl] ethanesulfonate.
| Compound Name | [4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 175271085 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(C=CC(=O)NO)cc1 |
| InChI | InChI=1S/C11H13NO5S/c1-2-18(15,16)17-10-6-3-9(4-7-10)5-8-11(13)12-14/h3-8,14H,2H2,1H3,(H,12,13) |
| InChIKey | GJSCKXNWLZJMFO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|