C23H16F6N2O4S — CID 155155573
(E)-3-[4-[[(4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 155155573) has the molecular formula C23H16F6N2O4S and a molecular weight of 530.45 g/mol. Its IUPAC name is (E)-3-[4-[[(4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[(4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 155155573 |
| Molecular Formula | C23H16F6N2O4S |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | (E)-3-[4-[[(4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CN(Cc2ccc(F)cc2)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1)NO |
| InChI | InChI=1S/C23H16F6N2O4S/c24-16-8-5-15(6-9-16)12-31(11-14-3-1-13(2-4-14)7-10-17(32)30-33)36(34,35)23-21(28)19(26)18(25)20(27)22(23)29/h1-10,33H,11-12H2,(H,30,32)/b10-7+ |
| InChIKey | RHONYNZOYYFQEX-JXMROGBWSA-N |
| XLogP | 4.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|